C16H22FN — CID 134527108
N-[4-fluoro-2-(4-methylidenehexan-2-yl)phenyl]propan-2-imine (PubChem CID 134527108) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[4-fluoro-2-(4-methylidenehexan-2-yl)phenyl]propan-2-imine.
| Compound Name | N-[4-fluoro-2-(4-methylidenehexan-2-yl)phenyl]propan-2-imine |
|---|---|
| PubChem CID | 134527108 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[4-fluoro-2-(4-methylidenehexan-2-yl)phenyl]propan-2-imine |
| SMILES | C=C(CC)CC(C)c1cc(F)ccc1N=C(C)C |
| InChI | InChI=1S/C16H22FN/c1-6-12(4)9-13(5)15-10-14(17)7-8-16(15)18-11(2)3/h7-8,10,13H,4,6,9H2,1-3,5H3 |
| InChIKey | FQRBYUDMGRQTOW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|