About 4-propan-2-ylsulfanyl-1,2-dihydrotriazete
4-propan-2-ylsulfanyl-1,2-dihydrotriazete (PubChem CID 134527708) has the molecular formula C4H9N3S
and a molecular weight of 131.20 g/mol. Its IUPAC name is 4-propan-2-ylsulfanyl-1,2-dihydrotriazete.
Molecular Properties
| Compound Name | 4-propan-2-ylsulfanyl-1,2-dihydrotriazete |
| PubChem CID | 134527708 |
| Molecular Formula | C4H9N3S |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 4-propan-2-ylsulfanyl-1,2-dihydrotriazete |
| SMILES | CC(C)Sc1n[nH][nH]1 |
| InChI | InChI=1S/C4H9N3S/c1-3(2)8-4-5-7-6-4/h3,7H,1-2H3,(H,5,6) |
| InChIKey | CAMYWEVXNCKNFN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-ylsulfanyl-1,2-dihydrotriazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylsulfanyl-1,2-dihydrotriazete?
The IUPAC name of 4-propan-2-ylsulfanyl-1,2-dihydrotriazete (CID 134527708) is 4-propan-2-ylsulfanyl-1,2-dihydrotriazete.
What is the SMILES notation for 4-propan-2-ylsulfanyl-1,2-dihydrotriazete?
The canonical SMILES for 4-propan-2-ylsulfanyl-1,2-dihydrotriazete is CC(C)Sc1n[nH][nH]1.
What is the InChIKey of 4-propan-2-ylsulfanyl-1,2-dihydrotriazete?
The InChIKey is CAMYWEVXNCKNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3S/c1-3(2)8-4-5-7-6-4/h3,7H,1-2H3,(H,5,6).
What are the key properties of 4-propan-2-ylsulfanyl-1,2-dihydrotriazete?
4-propan-2-ylsulfanyl-1,2-dihydrotriazete has a molecular weight of 131.20 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylsulfanyl-1,2-dihydrotriazete is sourced from PubChem (CID 134527708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).