About 4,5-dihydro-1H-thieno[2,3-g]indazole
4,5-dihydro-1H-thieno[2,3-g]indazole (PubChem CID 13452859) has the molecular formula C9H8N2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 4,5-dihydro-1H-thieno[2,3-g]indazole.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-thieno[2,3-g]indazole |
| PubChem CID | 13452859 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 4,5-dihydro-1H-thieno[2,3-g]indazole |
| SMILES | c1cc2c(s1)CCc1cn[nH]c1-2 |
| InChI | InChI=1S/C9H8N2S/c1-2-8-7(3-4-12-8)9-6(1)5-10-11-9/h3-5H,1-2H2,(H,10,11) |
| InChIKey | DKVMJCMHPQSNGP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dihydro-1H-thieno[2,3-g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-thieno[2,3-g]indazole?
The IUPAC name of 4,5-dihydro-1H-thieno[2,3-g]indazole (CID 13452859) is 4,5-dihydro-1H-thieno[2,3-g]indazole.
What is the SMILES notation for 4,5-dihydro-1H-thieno[2,3-g]indazole?
The canonical SMILES for 4,5-dihydro-1H-thieno[2,3-g]indazole is c1cc2c(s1)CCc1cn[nH]c1-2.
What is the InChIKey of 4,5-dihydro-1H-thieno[2,3-g]indazole?
The InChIKey is DKVMJCMHPQSNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S/c1-2-8-7(3-4-12-8)9-6(1)5-10-11-9/h3-5H,1-2H2,(H,10,11).
What are the key properties of 4,5-dihydro-1H-thieno[2,3-g]indazole?
4,5-dihydro-1H-thieno[2,3-g]indazole has a molecular weight of 176.24 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-thieno[2,3-g]indazole is sourced from PubChem (CID 13452859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).