C38H54N6O7 — CID 134528638
tert-butyl N-[(5S)-6-amino-5-[[(2S)-1-[(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-6-oxohexyl]carbamate (PubChem CID 134528638) has the molecular formula C38H54N6O7 and a molecular weight of 706.89 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-amino-5-[[(2S)-1-[(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-amino-5-[[(2S)-1-[(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 134528638 |
| Molecular Formula | C38H54N6O7 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | tert-butyl N-[(5S)-6-amino-5-[[(2S)-1-[(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C38H54N6O7/c1-25(2)23-30(43-34(47)29(24-26-15-8-6-9-16-26)42-33(46)27-17-10-7-11-18-27)36(49)44-22-14-20-31(44)35(48)41-28(32(39)45)19-12-13-21-40-37(50)51-38(3,4)5/h6-11,15-18,25,28-31H,12-14,19-24H2,1-5H3,(H2,39,45)(H,40,50)(H,41,48)(H,42,46)(H,43,47)/t28-,29-,30-,31-/m0/s1 |
| InChIKey | XWXLSHDRGLBSMW-ORYMTKCHSA-N |
| XLogP | 3.21 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|