C23H18N4S — CID 13452888
3-(2,2-diphenylethyl)-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 13452888) has the molecular formula C23H18N4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-(2,2-diphenylethyl)-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2,2-diphenylethyl)-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 13452888 |
| Molecular Formula | C23H18N4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-(2,2-diphenylethyl)-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | c1ccc(-c2nn3c(CC(c4ccccc4)c4ccccc4)nnc3s2)cc1 |
| InChI | InChI=1S/C23H18N4S/c1-4-10-17(11-5-1)20(18-12-6-2-7-13-18)16-21-24-25-23-27(21)26-22(28-23)19-14-8-3-9-15-19/h1-15,20H,16H2 |
| InChIKey | BBJPDNVYQZLRHO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |