About 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine
6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 134530161) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine.
Molecular Properties
| Compound Name | 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine |
| PubChem CID | 134530161 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CCCN1CCOc2cc(N)c(C)cc21 |
| InChI | InChI=1S/C12H18N2O/c1-3-4-14-5-6-15-12-8-10(13)9(2)7-11(12)14/h7-8H,3-6,13H2,1-2H3 |
| InChIKey | WVEYPGQGVWEBPG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine?
The IUPAC name of 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine (CID 134530161) is 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine.
What is the SMILES notation for 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine?
The canonical SMILES for 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine is CCCN1CCOc2cc(N)c(C)cc21.
What is the InChIKey of 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine?
The InChIKey is WVEYPGQGVWEBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-3-4-14-5-6-15-12-8-10(13)9(2)7-11(12)14/h7-8H,3-6,13H2,1-2H3.
What are the key properties of 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine?
6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine has a molecular weight of 206.29 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-propyl-2,3-dihydro-1,4-benzoxazin-7-amine is sourced from PubChem (CID 134530161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).