About 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine
1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine (PubChem CID 134530505) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine |
| PubChem CID | 134530505 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 1-methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine |
| SMILES | CN1CCN(CC1)C(=C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-7(8(9,10)11)13-5-3-12(2)4-6-13/h1,3-6H2,2H3 |
| InChIKey | MGBGJIPEPIIJGJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 192 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine?
The IUPAC name of 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine (CID 134530505) is 1-methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine.
What is the SMILES notation for 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine?
The canonical SMILES for 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine is CN1CCN(CC1)C(=C)C(F)(F)F.
What is the InChIKey of 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine?
The InChIKey is MGBGJIPEPIIJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-7(8(9,10)11)13-5-3-12(2)4-6-13/h1,3-6H2,2H3.
What are the key properties of 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine?
1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine has a molecular weight of 194.20 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Methyl-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazine is sourced from PubChem (CID 134530505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).