About dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate
dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate (PubChem CID 134530933) has the molecular formula C29H32O6S
and a molecular weight of 508.64 g/mol. Its IUPAC name is dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate.
Molecular Properties
| Compound Name | dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
| PubChem CID | 134530933 |
| Molecular Formula | C29H32O6S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
| SMILES | Cc1ccc(S(=O)(=O)CC(C)(CC(C)C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32O6S/c1-22-14-16-26(17-15-22)36(32,33)21-29(3,28(31)35-20-25-12-8-5-9-13-25)18-23(2)27(30)34-19-24-10-6-4-7-11-24/h4-17,23H,18-21H2,1-3H3 |
| InChIKey | OAVYZLFIULXYOR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate?
The IUPAC name of dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate (CID 134530933) is dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate.
What is the SMILES notation for dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate?
The canonical SMILES for dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate is Cc1ccc(S(=O)(=O)CC(C)(CC(C)C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1.
What is the InChIKey of dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate?
The InChIKey is OAVYZLFIULXYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32O6S/c1-22-14-16-26(17-15-22)36(32,33)21-29(3,28(31)35-20-25-12-8-5-9-13-25)18-23(2)27(30)34-19-24-10-6-4-7-11-24/h4-17,23H,18-21H2,1-3H3.
What are the key properties of dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate?
dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate has a molecular weight of 508.64 g/mol, XLogP of 5.29, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate is sourced from PubChem (CID 134530933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).