C34H38O9S — CID 134530935
3-O,5-O-dibenzyl 1-O-ethyl 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-oxohexane-1,3,5-tricarboxylate (PubChem CID 134530935) has the molecular formula C34H38O9S and a molecular weight of 622.74 g/mol. Its IUPAC name is 3-O,5-O-dibenzyl 1-O-ethyl 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-oxohexane-1,3,5-tricarboxylate.
| Compound Name | 3-O,5-O-dibenzyl 1-O-ethyl 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-oxohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134530935 |
| Molecular Formula | C34H38O9S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 3-O,5-O-dibenzyl 1-O-ethyl 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-oxohexane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C(=O)CC(C)(CC(C)(CS(=O)(=O)c1ccc(C)cc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H38O9S/c1-5-41-30(36)29(35)20-33(3,31(37)42-21-26-12-8-6-9-13-26)23-34(4,32(38)43-22-27-14-10-7-11-15-27)24-44(39,40)28-18-16-25(2)17-19-28/h6-19H,5,20-24H2,1-4H3 |
| InChIKey | PEBMIWFJNLCJOY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|