C8H12F5N — CID 134531030
1,2-difluoro-N,N,3-trimethyl-2-(trifluoromethyl)but-3-en-1-amine (PubChem CID 134531030) has the molecular formula C8H12F5N and a molecular weight of 217.18 g/mol. Its IUPAC name is 1,2-difluoro-N,N,3-trimethyl-2-(trifluoromethyl)but-3-en-1-amine.
| Compound Name | 1,2-difluoro-N,N,3-trimethyl-2-(trifluoromethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 134531030 |
| Molecular Formula | C8H12F5N |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1,2-difluoro-N,N,3-trimethyl-2-(trifluoromethyl)but-3-en-1-amine |
| SMILES | C=C(C)C(F)(C(F)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12F5N/c1-5(2)7(10,8(11,12)13)6(9)14(3)4/h6H,1H2,2-4H3 |
| InChIKey | SMGAGSHAYMERRJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|