C10H15F5N2 — CID 134531055
1-methyl-4-(1,1,1,3,3-pentafluoropent-4-en-2-yl)piperazine (PubChem CID 134531055) has the molecular formula C10H15F5N2 and a molecular weight of 258.23 g/mol. Its IUPAC name is 1-methyl-4-(1,1,1,3,3-pentafluoropent-4-en-2-yl)piperazine.
| Compound Name | 1-methyl-4-(1,1,1,3,3-pentafluoropent-4-en-2-yl)piperazine |
|---|---|
| PubChem CID | 134531055 |
| Molecular Formula | C10H15F5N2 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-methyl-4-(1,1,1,3,3-pentafluoropent-4-en-2-yl)piperazine |
| SMILES | C=CC(F)(F)C(N1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H15F5N2/c1-3-9(11,12)8(10(13,14)15)17-6-4-16(2)5-7-17/h3,8H,1,4-7H2,2H3 |
| InChIKey | OFRRSYPTFLDODL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|