C11H18F3NO — CID 134531057
2,6-dimethyl-4-(1,2,2-trifluoro-3-methylbut-3-enyl)morpholine (PubChem CID 134531057) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,2,2-trifluoro-3-methylbut-3-enyl)morpholine.
| Compound Name | 2,6-dimethyl-4-(1,2,2-trifluoro-3-methylbut-3-enyl)morpholine |
|---|---|
| PubChem CID | 134531057 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2,6-dimethyl-4-(1,2,2-trifluoro-3-methylbut-3-enyl)morpholine |
| SMILES | C=C(C)C(F)(F)C(F)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H18F3NO/c1-7(2)11(13,14)10(12)15-5-8(3)16-9(4)6-15/h8-10H,1,5-6H2,2-4H3 |
| InChIKey | LKQFMZZRDMSYGI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|