About 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine
1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine (PubChem CID 134531077) has the molecular formula C11H17F5N2
and a molecular weight of 272.26 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine |
| PubChem CID | 134531077 |
| Molecular Formula | C11H17F5N2 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine |
| SMILES | C=C(C)C(F)(C(F)N1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F5N2/c1-8(2)10(13,11(14,15)16)9(12)18-6-4-17(3)5-7-18/h9H,1,4-7H2,2-3H3 |
| InChIKey | PSLPVCPPGMCYKW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine?
The IUPAC name of 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine (CID 134531077) is 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine.
What is the SMILES notation for 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine?
The canonical SMILES for 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine is C=C(C)C(F)(C(F)N1CCN(C)CC1)C(F)(F)F.
What is the InChIKey of 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine?
The InChIKey is PSLPVCPPGMCYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F5N2/c1-8(2)10(13,11(14,15)16)9(12)18-6-4-17(3)5-7-18/h9H,1,4-7H2,2-3H3.
What are the key properties of 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine?
1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine has a molecular weight of 272.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-methylpiperazine is sourced from PubChem (CID 134531077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).