C36H30BrN — CID 134531082
5-bromo-2-[3-[3-(2,2-dimethylpropyl)phenyl]-10-phenylanthracen-9-yl]pyridine (PubChem CID 134531082) has the molecular formula C36H30BrN and a molecular weight of 556.55 g/mol. Its IUPAC name is 5-bromo-2-[3-[3-(2,2-dimethylpropyl)phenyl]-10-phenylanthracen-9-yl]pyridine.
| Compound Name | 5-bromo-2-[3-[3-(2,2-dimethylpropyl)phenyl]-10-phenylanthracen-9-yl]pyridine |
|---|---|
| PubChem CID | 134531082 |
| Molecular Formula | C36H30BrN |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 5-bromo-2-[3-[3-(2,2-dimethylpropyl)phenyl]-10-phenylanthracen-9-yl]pyridine |
| SMILES | CC(C)(C)Cc1cccc(-c2ccc3c(-c4ccc(Br)cn4)c4ccccc4c(-c4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C36H30BrN/c1-36(2,3)22-24-10-9-13-26(20-24)27-16-18-31-32(21-27)34(25-11-5-4-6-12-25)29-14-7-8-15-30(29)35(31)33-19-17-28(37)23-38-33/h4-21,23H,22H2,1-3H3 |
| InChIKey | GMLAVEBPWCLGAU-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|