C14H9F19O3 — CID 134531086
3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propoxy]-2-methylbut-1-ene (PubChem CID 134531086) has the molecular formula C14H9F19O3 and a molecular weight of 586.18 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propoxy]-2-methylbut-1-ene.
| Compound Name | 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propoxy]-2-methylbut-1-ene |
|---|---|
| PubChem CID | 134531086 |
| Molecular Formula | C14H9F19O3 |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propoxy]-2-methylbut-1-ene |
| SMILES | C=C(C)C(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(C)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H9F19O3/c1-4(2)7(18,19)5(15)34-13(30,31)8(20,10(22,23)24)36-14(32,33)9(21,11(25,26)27)35-12(28,29)6(3,16)17/h5H,1H2,2-3H3 |
| InChIKey | OSRSQHSGYIIPFY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|