C46H50F2N4S3 — CID 134531207
4,9-bis[5-[4-(2-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 134531207) has the molecular formula C46H50F2N4S3 and a molecular weight of 793.13 g/mol. Its IUPAC name is 4,9-bis[5-[4-(2-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis[5-[4-(2-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 134531207 |
| Molecular Formula | C46H50F2N4S3 |
| Molecular Weight | 793.13 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | 4,9-bis[5-[4-(2-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCCC(CC)Cc1ccc(-c2ccc(-c3c4nccnc4c(-c4ccc(-c5ccc(CC(CC)CCCCC)cc5F)s4)c4nsnc34)s2)c(F)c1 |
| InChI | InChI=1S/C46H50F2N4S3/c1-5-9-11-13-29(7-3)25-31-15-17-33(35(47)27-31)37-19-21-39(53-37)41-43-44(50-24-23-49-43)42(46-45(41)51-55-52-46)40-22-20-38(54-40)34-18-16-32(28-36(34)48)26-30(8-4)14-12-10-6-2/h15-24,27-30H,5-14,25-26H2,1-4H3 |
| InChIKey | GTJZQLJQWQGWBN-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.13 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|