C17H24IN5O3 — CID 134531338
tert-butyl (3R)-3-(4-amino-3-iodo-7-methoxypyrazolo[4,5-c]pyridin-1-yl)piperidine-1-carboxylate (PubChem CID 134531338) has the molecular formula C17H24IN5O3 and a molecular weight of 473.32 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-amino-3-iodo-7-methoxypyrazolo[4,5-c]pyridin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-amino-3-iodo-7-methoxypyrazolo[4,5-c]pyridin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134531338 |
| Molecular Formula | C17H24IN5O3 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | tert-butyl (3R)-3-(4-amino-3-iodo-7-methoxypyrazolo[4,5-c]pyridin-1-yl)piperidine-1-carboxylate |
| SMILES | COc1cnc(N)c2c(I)nn([C@@H]3CCCN(C(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C17H24IN5O3/c1-17(2,3)26-16(24)22-7-5-6-10(9-22)23-13-11(25-4)8-20-15(19)12(13)14(18)21-23/h8,10H,5-7,9H2,1-4H3,(H2,19,20)/t10-/m1/s1 |
| InChIKey | CAEBYJKRAJSUIY-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|