About trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide
trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide (PubChem CID 134532073) has the molecular formula C5H9FN2O
and a molecular weight of 132.14 g/mol. Its IUPAC name is trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide.
Molecular Properties
| Compound Name | trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide |
| PubChem CID | 134532073 |
| Molecular Formula | C5H9FN2O |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1CC[C@H]1F |
| InChI | InChI=1S/C5H9FN2O/c6-4-2-1-3(4)5(9)8-7/h3-4H,1-2,7H2,(H,8,9)/t3-,4-/m1/s1 |
| InChIKey | OOPOFSDQIWAHIS-QWWZWVQMSA-N |
| XLogP | -0.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide?
The IUPAC name of trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide (CID 134532073) is trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide.
What is the SMILES notation for trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide?
The canonical SMILES for trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide is NNC(=O)[C@@H]1CC[C@H]1F.
What is the InChIKey of trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide?
The InChIKey is OOPOFSDQIWAHIS-QWWZWVQMSA-N. The full InChI is InChI=1S/C5H9FN2O/c6-4-2-1-3(4)5(9)8-7/h3-4H,1-2,7H2,(H,8,9)/t3-,4-/m1/s1.
What are the key properties of trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide?
trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide has a molecular weight of 132.14 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-fluorocyclobutane-1-carbohydrazide is sourced from PubChem (CID 134532073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).