C8H8F3N — CID 134532241
(3Z)-N-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-imine (PubChem CID 134532241) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is (3Z)-N-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-imine.
| Compound Name | (3Z)-N-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 134532241 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (3Z)-N-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-imine |
| SMILES | C=C/C=C\C(=N/C=C)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N/c1-3-5-6-7(12-4-2)8(9,10)11/h3-6H,1-2H2/b6-5-,12-7+ |
| InChIKey | BEGLQOOIFBZKJA-UNKATYBDSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|