C40H54N2O4 — CID 134532573
(2S,3S,4S,5S)-4-[[5-(1-adamantyl)-2-methoxyphenyl]methylamino]-3-tert-butyl-1-(cyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 134532573) has the molecular formula C40H54N2O4 and a molecular weight of 626.88 g/mol. Its IUPAC name is (2S,3S,4S,5S)-4-[[5-(1-adamantyl)-2-methoxyphenyl]methylamino]-3-tert-butyl-1-(cyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-4-[[5-(1-adamantyl)-2-methoxyphenyl]methylamino]-3-tert-butyl-1-(cyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134532573 |
| Molecular Formula | C40H54N2O4 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.41 |
| IUPAC Name | (2S,3S,4S,5S)-4-[[5-(1-adamantyl)-2-methoxyphenyl]methylamino]-3-tert-butyl-1-(cyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C2CCCCC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C40H54N2O4/c1-39(2,3)33-34(35(28-11-7-5-8-12-28)42(36(33)38(44)45)37(43)29-13-9-6-10-14-29)41-24-30-20-31(15-16-32(30)46-4)40-21-25-17-26(22-40)19-27(18-25)23-40/h5,7-8,11-12,15-16,20,25-27,29,33-36,41H,6,9-10,13-14,17-19,21-24H2,1-4H3,(H,44,45)/t25?,26?,27?,33-,34-,35-,36-,40?/m0/s1 |
| InChIKey | DPRKNWJDUFJKIX-HHPCUSBKSA-N |
| XLogP | 7.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |