C14H20N4O3 — CID 134533058
2-[4,7-bis(2-oxoethenyl)-1,4,7,10-tetrazacyclododec-1-yl]ethenone (PubChem CID 134533058) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[4,7-bis(2-oxoethenyl)-1,4,7,10-tetrazacyclododec-1-yl]ethenone.
| Compound Name | 2-[4,7-bis(2-oxoethenyl)-1,4,7,10-tetrazacyclododec-1-yl]ethenone |
|---|---|
| PubChem CID | 134533058 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[4,7-bis(2-oxoethenyl)-1,4,7,10-tetrazacyclododec-1-yl]ethenone |
| SMILES | O=C=CN1CCNCCN(C=C=O)CCN(C=C=O)CC1 |
| InChI | InChI=1S/C14H20N4O3/c19-12-9-16-3-1-15-2-4-17(10-13-20)6-8-18(7-5-16)11-14-21/h9-11,15H,1-8H2 |
| InChIKey | AVEXAMDLNSEFNE-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|