C13H10F6O2 — CID 134533451
(3Z,7Z)-3,7,8-trifluoro-5,6-dimethylidene-2-(trifluoromethoxy)deca-1,3,7,9-tetraen-4-ol (PubChem CID 134533451) has the molecular formula C13H10F6O2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (3Z,7Z)-3,7,8-trifluoro-5,6-dimethylidene-2-(trifluoromethoxy)deca-1,3,7,9-tetraen-4-ol.
| Compound Name | (3Z,7Z)-3,7,8-trifluoro-5,6-dimethylidene-2-(trifluoromethoxy)deca-1,3,7,9-tetraen-4-ol |
|---|---|
| PubChem CID | 134533451 |
| Molecular Formula | C13H10F6O2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (3Z,7Z)-3,7,8-trifluoro-5,6-dimethylidene-2-(trifluoromethoxy)deca-1,3,7,9-tetraen-4-ol |
| SMILES | C=C/C(F)=C(/F)C(=C)C(=C)/C(O)=C(/F)C(=C)OC(F)(F)F |
| InChI | InChI=1S/C13H10F6O2/c1-5-9(14)10(15)6(2)7(3)12(20)11(16)8(4)21-13(17,18)19/h5,20H,1-4H2/b10-9-,12-11- |
| InChIKey | JYGQRHZTJVGKOO-BASFJDSNSA-N |
| XLogP | 5.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|