C10H20N2 — CID 134533614
1,2-dimethyl-1-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]hydrazine (PubChem CID 134533614) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]hydrazine.
| Compound Name | 1,2-dimethyl-1-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 134533614 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1,2-dimethyl-1-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]hydrazine |
| SMILES | C/C=C(\C=C/C(C)C)N(C)NC |
| InChI | InChI=1S/C10H20N2/c1-6-10(12(5)11-4)8-7-9(2)3/h6-9,11H,1-5H3/b8-7-,10-6+ |
| InChIKey | AZXRLQITIIYKCB-SDHBEMGISA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|