About (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol
(1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol (PubChem CID 134533651) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol |
| PubChem CID | 134533651 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol |
| SMILES | CC1=CC([C@H](O)[C@H](C)N)CC=C1 |
| InChI | InChI=1S/C10H17NO/c1-7-4-3-5-9(6-7)10(12)8(2)11/h3-4,6,8-10,12H,5,11H2,1-2H3/t8-,9?,10+/m0/s1 |
| InChIKey | GRTAXNOAMXPRTJ-DJBFQZMMSA-N |
| XLogP | 1.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The IUPAC name of (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol (CID 134533651) is (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol.
What is the SMILES notation for (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The canonical SMILES for (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol is CC1=CC([C@H](O)[C@H](C)N)CC=C1.
What is the InChIKey of (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The InChIKey is GRTAXNOAMXPRTJ-DJBFQZMMSA-N. The full InChI is InChI=1S/C10H17NO/c1-7-4-3-5-9(6-7)10(12)8(2)11/h3-4,6,8-10,12H,5,11H2,1-2H3/t8-,9?,10+/m0/s1.
What are the key properties of (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
(1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-amino-1-(3-methylcyclohexa-2,4-dien-1-yl)propan-1-ol is sourced from PubChem (CID 134533651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).