C23H32N4O4 — CID 134533903
2-[3-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-1-methoxypropyl]-4-(2-methoxyethyl)-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 134533903) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[3-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-1-methoxypropyl]-4-(2-methoxyethyl)-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 2-[3-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-1-methoxypropyl]-4-(2-methoxyethyl)-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 134533903 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-[3-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-1-methoxypropyl]-4-(2-methoxyethyl)-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | COCCN1CC(C(CCN2CCOc3cc(N)ccc32)OC)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C23H32N4O4/c1-28-11-9-27-15-23(31-22-14-17(25)4-6-19(22)27)20(29-2)7-8-26-10-12-30-21-13-16(24)3-5-18(21)26/h3-6,13-14,20,23H,7-12,15,24-25H2,1-2H3 |
| InChIKey | MSJXHSZNXFWYSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|