(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid

C9H13F2NO2 — CID 134533989

IUPAC(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid
SMILESCN1CC(/C=C/C(=O)O)CC(F)(F)C1
InChIInChI=1S/C9H13F2NO2/c1-12-5-7(2-3-8(13)14)4-9(10,11)6-12/h2-3,7H,4-6H2,1H3,(H,13,14)/b3-2+
InChIKeyVJDFWDOCISVIAC-NSCUHMNNSA-N
MW205.20 g/mol
LogP1.21
Rot. Bonds2

About (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid

(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid (PubChem CID 134533989) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid
PubChem CID134533989
Molecular FormulaC9H13F2NO2
Molecular Weight205.20 g/mol
Exact Mass205.09
IUPAC Name(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid
SMILESCN1CC(/C=C/C(=O)O)CC(F)(F)C1
InChIInChI=1S/C9H13F2NO2/c1-12-5-7(2-3-8(13)14)4-9(10,11)6-12/h2-3,7H,4-6H2,1H3,(H,13,14)/b3-2+
InChIKeyVJDFWDOCISVIAC-NSCUHMNNSA-N
XLogP1.21
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.20
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid (CID 134533989) is (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid is CN1CC(/C=C/C(=O)O)CC(F)(F)C1.
What is the InChIKey of (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid?
The InChIKey is VJDFWDOCISVIAC-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H13F2NO2/c1-12-5-7(2-3-8(13)14)4-9(10,11)6-12/h2-3,7H,4-6H2,1H3,(H,13,14)/b3-2+.
What are the key properties of (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid?
(E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid has a molecular weight of 205.20 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(5,5-difluoro-1-methylpiperidin-3-yl)prop-2-enoic acid is sourced from PubChem (CID 134533989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).