C15H16O2 — CID 134534186
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4a,8a-dihydrochromen-4-one (PubChem CID 134534186) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4a,8a-dihydrochromen-4-one.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4a,8a-dihydrochromen-4-one |
|---|---|
| PubChem CID | 134534186 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4a,8a-dihydrochromen-4-one |
| SMILES | C/C=C\C(=C/C)C1=CC(=O)C2C=CC=CC2O1 |
| InChI | InChI=1S/C15H16O2/c1-3-7-11(4-2)15-10-13(16)12-8-5-6-9-14(12)17-15/h3-10,12,14H,1-2H3/b7-3-,11-4+ |
| InChIKey | LSQGRRWXDQJVEF-VGQHJLIWSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|