C4HF8N — CID 134534210
(Z)-N,1,3,3,3-pentafluoro-N-(trifluoromethyl)prop-1-en-1-amine (PubChem CID 134534210) has the molecular formula C4HF8N and a molecular weight of 215.04 g/mol. Its IUPAC name is (Z)-N,1,3,3,3-pentafluoro-N-(trifluoromethyl)prop-1-en-1-amine.
| Compound Name | (Z)-N,1,3,3,3-pentafluoro-N-(trifluoromethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 134534210 |
| Molecular Formula | C4HF8N |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | (Z)-N,1,3,3,3-pentafluoro-N-(trifluoromethyl)prop-1-en-1-amine |
| SMILES | F/C(=C\C(F)(F)F)N(F)C(F)(F)F |
| InChI | InChI=1S/C4HF8N/c5-2(1-3(6,7)8)13(12)4(9,10)11/h1H/b2-1+ |
| InChIKey | PCCBFUYPGQXYCE-OWOJBTEDSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|