C34H44N4 — CID 134534328
2-(aminomethyl)-6-[(1E,3E)-1-(1,2-dihydropyridin-4-yl)hexa-1,3,5-trien-3-yl]-N-[(5Z,7E,9E)-11-methyliminoundeca-5,7,9-trien-4-yl]-1,2,5,6-tetrahydronaphthalen-1-amine (PubChem CID 134534328) has the molecular formula C34H44N4 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[(1E,3E)-1-(1,2-dihydropyridin-4-yl)hexa-1,3,5-trien-3-yl]-N-[(5Z,7E,9E)-11-methyliminoundeca-5,7,9-trien-4-yl]-1,2,5,6-tetrahydronaphthalen-1-amine.
| Compound Name | 2-(aminomethyl)-6-[(1E,3E)-1-(1,2-dihydropyridin-4-yl)hexa-1,3,5-trien-3-yl]-N-[(5Z,7E,9E)-11-methyliminoundeca-5,7,9-trien-4-yl]-1,2,5,6-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 134534328 |
| Molecular Formula | C34H44N4 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 2-(aminomethyl)-6-[(1E,3E)-1-(1,2-dihydropyridin-4-yl)hexa-1,3,5-trien-3-yl]-N-[(5Z,7E,9E)-11-methyliminoundeca-5,7,9-trien-4-yl]-1,2,5,6-tetrahydronaphthalen-1-amine |
| SMILES | C=C/C=C(\C=C\C1=CCNC=C1)C1C=CC2=C(C=CC(CN)C2NC(/C=C\C=C\C=C\C=N\C)CCC)C1 |
| InChI | InChI=1S/C34H44N4/c1-4-11-28(15-14-27-20-23-37-24-21-27)29-18-19-33-30(25-29)16-17-31(26-35)34(33)38-32(12-5-2)13-9-7-6-8-10-22-36-3/h4,6-11,13-23,29,31-32,34,37-38H,1,5,12,24-26,35H2,2-3H3/b7-6+,10-8+,13-9-,15-14+,28-11+,36-22+ |
| InChIKey | FKNREFCCGLZGCE-SEGMIGRVSA-N |
| XLogP | 6.21 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|