About 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol
5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol (PubChem CID 134534573) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 134534573 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol |
| SMILES | OC1=CC(CCNCCC2CCC(O)CC2)=CC(O)C1 |
| InChI | InChI=1S/C16H27NO3/c18-14-3-1-12(2-4-14)5-7-17-8-6-13-9-15(19)11-16(20)10-13/h9-10,12,14-15,17-20H,1-8,11H2 |
| InChIKey | QDCMEJUKUIGMLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol?
The IUPAC name of 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol (CID 134534573) is 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol is OC1=CC(CCNCCC2CCC(O)CC2)=CC(O)C1.
What is the InChIKey of 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol?
The InChIKey is QDCMEJUKUIGMLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO3/c18-14-3-1-12(2-4-14)5-7-17-8-6-13-9-15(19)11-16(20)10-13/h9-10,12,14-15,17-20H,1-8,11H2.
What are the key properties of 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol?
5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol has a molecular weight of 281.40 g/mol, XLogP of 2.04, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2-(4-hydroxycyclohexyl)ethylamino]ethyl]cyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 134534573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).