C15H28N2O — CID 134534587
1-[(2E,4Z)-2-methoxy-4,6-dimethylhepta-2,4-dienyl]-4-methylpiperazine (PubChem CID 134534587) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-methoxy-4,6-dimethylhepta-2,4-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(2E,4Z)-2-methoxy-4,6-dimethylhepta-2,4-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 134534587 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[(2E,4Z)-2-methoxy-4,6-dimethylhepta-2,4-dienyl]-4-methylpiperazine |
| SMILES | CO/C(=C/C(C)=C\C(C)C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H28N2O/c1-13(2)10-14(3)11-15(18-5)12-17-8-6-16(4)7-9-17/h10-11,13H,6-9,12H2,1-5H3/b14-10-,15-11+ |
| InChIKey | DMSSFKYNFZZSRW-YCRUPXPOSA-N |
| XLogP | 2.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|