C26H25ClFN5O5 — CID 134535130
(4S)-4-[[1-(3-chloro-2-fluorophenyl)-5-methylimidazole-4-carbonyl]amino]-3,10-dioxo-2,11-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylic acid (PubChem CID 134535130) has the molecular formula C26H25ClFN5O5 and a molecular weight of 541.97 g/mol. Its IUPAC name is (4S)-4-[[1-(3-chloro-2-fluorophenyl)-5-methylimidazole-4-carbonyl]amino]-3,10-dioxo-2,11-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylic acid.
| Compound Name | (4S)-4-[[1-(3-chloro-2-fluorophenyl)-5-methylimidazole-4-carbonyl]amino]-3,10-dioxo-2,11-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylic acid |
|---|---|
| PubChem CID | 134535130 |
| Molecular Formula | C26H25ClFN5O5 |
| Molecular Weight | 541.97 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (4S)-4-[[1-(3-chloro-2-fluorophenyl)-5-methylimidazole-4-carbonyl]amino]-3,10-dioxo-2,11-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylic acid |
| SMILES | Cc1c(C(=O)N[C@H]2CCCCCC(=O)Nc3cc(C(=O)O)ccc3NC2=O)ncn1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C26H25ClFN5O5/c1-14-23(29-13-33(14)20-8-5-6-16(27)22(20)28)25(36)32-18-7-3-2-4-9-21(34)30-19-12-15(26(37)38)10-11-17(19)31-24(18)35/h5-6,8,10-13,18H,2-4,7,9H2,1H3,(H,30,34)(H,31,35)(H,32,36)(H,37,38)/t18-/m0/s1 |
| InChIKey | NOIOPHQLFYDBRS-SFHVURJKSA-N |
| XLogP | 4.31 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |