About (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane
(5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane (PubChem CID 134535251) has the molecular formula C8H13NOS
and a molecular weight of 171.26 g/mol. Its IUPAC name is (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane |
| PubChem CID | 134535251 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane |
| SMILES | CC1(C)CC[C@@H](CN=C=S)O1 |
| InChI | InChI=1S/C8H13NOS/c1-8(2)4-3-7(10-8)5-9-6-11/h7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | QCFYDPPJUNXBJF-ZETCQYMHSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane?
The IUPAC name of (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane (CID 134535251) is (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane.
What is the SMILES notation for (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane?
The canonical SMILES for (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane is CC1(C)CC[C@@H](CN=C=S)O1.
What is the InChIKey of (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane?
The InChIKey is QCFYDPPJUNXBJF-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NOS/c1-8(2)4-3-7(10-8)5-9-6-11/h7H,3-5H2,1-2H3/t7-/m0/s1.
What are the key properties of (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane?
(5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane has a molecular weight of 171.26 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(isothiocyanatomethyl)-2,2-dimethyloxolane is sourced from PubChem (CID 134535251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).