About (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone
(6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone (PubChem CID 134535281) has the molecular formula C16H11Br3N2O2
and a molecular weight of 502.99 g/mol. Its IUPAC name is (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone |
| PubChem CID | 134535281 |
| Molecular Formula | C16H11Br3N2O2 |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 499.84 |
| IUPAC Name | (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone |
| SMILES | CCc1nc2ccc(Br)cn2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H11Br3N2O2/c1-2-12-14(21-7-9(17)3-4-13(21)20-12)15(22)8-5-10(18)16(23)11(19)6-8/h3-7,23H,2H2,1H3 |
| InChIKey | UOQKGNNBKCFJFD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone?
The IUPAC name of (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone (CID 134535281) is (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone.
What is the SMILES notation for (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone?
The canonical SMILES for (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone is CCc1nc2ccc(Br)cn2c1C(=O)c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone?
The InChIKey is UOQKGNNBKCFJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Br3N2O2/c1-2-12-14(21-7-9(17)3-4-13(21)20-12)15(22)8-5-10(18)16(23)11(19)6-8/h3-7,23H,2H2,1H3.
What are the key properties of (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone?
(6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone has a molecular weight of 502.99 g/mol, XLogP of 5.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2-ethylimidazo[1,2-a]pyridin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone is sourced from PubChem (CID 134535281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).