C27H30ClFN4O2 — CID 134535343
8-[2-amino-5-(4-chloro-5-fluoro-6-methyl-2-pyridinyl)-2,4-dimethylpentoxy]-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 134535343) has the molecular formula C27H30ClFN4O2 and a molecular weight of 497.01 g/mol. Its IUPAC name is 8-[2-amino-5-(4-chloro-5-fluoro-6-methyl-2-pyridinyl)-2,4-dimethylpentoxy]-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one.
| Compound Name | 8-[2-amino-5-(4-chloro-5-fluoro-6-methyl-2-pyridinyl)-2,4-dimethylpentoxy]-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 134535343 |
| Molecular Formula | C27H30ClFN4O2 |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 8-[2-amino-5-(4-chloro-5-fluoro-6-methyl-2-pyridinyl)-2,4-dimethylpentoxy]-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | Cc1nc(CC(C)CC(C)(N)COc2ccc3c(c2)c(=O)n(C)c2c(C)nccc32)cc(Cl)c1F |
| InChI | InChI=1S/C27H30ClFN4O2/c1-15(10-18-11-23(28)24(29)16(2)32-18)13-27(4,30)14-35-19-6-7-20-21-8-9-31-17(3)25(21)33(5)26(34)22(20)12-19/h6-9,11-12,15H,10,13-14,30H2,1-5H3 |
| InChIKey | RWQVDGUBXZEVGN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|