About N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide
N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 134535398) has the molecular formula C19H20N6OS
and a molecular weight of 380.48 g/mol. Its IUPAC name is N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 134535398 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ccc(-c2ccncc2)cc1NC(=O)c1cnc(N2CCNCC2)s1 |
| InChI | InChI=1S/C19H20N6OS/c20-15-2-1-14(13-3-5-21-6-4-13)11-16(15)24-18(26)17-12-23-19(27-17)25-9-7-22-8-10-25/h1-6,11-12,22H,7-10,20H2,(H,24,26) |
| InChIKey | ZTRWHUJIONDEEE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide (CID 134535398) is N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide is Nc1ccc(-c2ccncc2)cc1NC(=O)c1cnc(N2CCNCC2)s1.
What is the InChIKey of N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide?
The InChIKey is ZTRWHUJIONDEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6OS/c20-15-2-1-14(13-3-5-21-6-4-13)11-16(15)24-18(26)17-12-23-19(27-17)25-9-7-22-8-10-25/h1-6,11-12,22H,7-10,20H2,(H,24,26).
What are the key properties of N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide?
N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide has a molecular weight of 380.48 g/mol, XLogP of 2.45, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-5-pyridin-4-ylphenyl)-2-piperazin-1-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 134535398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).