C21H24Cl3N3O4 — CID 134535407
methyl N-[8-(2-amino-2,4-dimethylpentoxy)-1,4,7-trichloro-6H-isochromeno[3,4-c]pyridin-2-yl]carbamate (PubChem CID 134535407) has the molecular formula C21H24Cl3N3O4 and a molecular weight of 488.80 g/mol. Its IUPAC name is methyl N-[8-(2-amino-2,4-dimethylpentoxy)-1,4,7-trichloro-6H-isochromeno[3,4-c]pyridin-2-yl]carbamate.
| Compound Name | methyl N-[8-(2-amino-2,4-dimethylpentoxy)-1,4,7-trichloro-6H-isochromeno[3,4-c]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 134535407 |
| Molecular Formula | C21H24Cl3N3O4 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | methyl N-[8-(2-amino-2,4-dimethylpentoxy)-1,4,7-trichloro-6H-isochromeno[3,4-c]pyridin-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(Cl)c2c(c1Cl)-c1ccc(OCC(C)(N)CC(C)C)c(Cl)c1CO2 |
| InChI | InChI=1S/C21H24Cl3N3O4/c1-10(2)7-21(3,25)9-31-13-6-5-11-12(15(13)22)8-30-17-14(11)16(23)19(26-18(17)24)27-20(28)29-4/h5-6,10H,7-9,25H2,1-4H3,(H,26,27,28) |
| InChIKey | BHDUKCKQZNVVHY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|