C24H24ClNO6 — CID 134535683
[2-(2-chlorophenyl)-7-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-5-yl] propanoate (PubChem CID 134535683) has the molecular formula C24H24ClNO6 and a molecular weight of 457.91 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-7-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-5-yl] propanoate.
| Compound Name | [2-(2-chlorophenyl)-7-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-5-yl] propanoate |
|---|---|
| PubChem CID | 134535683 |
| Molecular Formula | C24H24ClNO6 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [2-(2-chlorophenyl)-7-hydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4-oxochromen-5-yl] propanoate |
| SMILES | CCC(=O)Oc1cc(O)c([C@H]2CCN(C)C[C@H]2O)c2oc(-c3ccccc3Cl)cc(=O)c12 |
| InChI | InChI=1S/C24H24ClNO6/c1-3-21(30)31-20-11-16(27)22(14-8-9-26(2)12-18(14)29)24-23(20)17(28)10-19(32-24)13-6-4-5-7-15(13)25/h4-7,10-11,14,18,27,29H,3,8-9,12H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | UNOWUXJEDQOVFB-KBXCAEBGSA-N |
| XLogP | 3.91 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|