C22H26ClF6N3O4 — CID 134536337
3-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]anilino]propanoic acid (PubChem CID 134536337) has the molecular formula C22H26ClF6N3O4 and a molecular weight of 545.91 g/mol. Its IUPAC name is 3-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]anilino]propanoic acid.
| Compound Name | 3-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 134536337 |
| Molecular Formula | C22H26ClF6N3O4 |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 3-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]anilino]propanoic acid |
| SMILES | O=C(O)CCNc1cc(Cl)cc(CN2CCCC23CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)c1 |
| InChI | InChI=1S/C22H26ClF6N3O4/c23-15-10-14(11-16(12-15)30-6-2-17(33)34)13-32-7-1-3-20(32)4-8-31(9-5-20)19(35)36-18(21(24,25)26)22(27,28)29/h10-12,18,30H,1-9,13H2,(H,33,34) |
| InChIKey | LKZYHIGWIAEDLV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |