C21H28ClF2N5S — CID 134536389
N'-[2-chloro-5-fluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N-(pyrrolidin-2-ylmethyl)pentane-1,5-diamine (PubChem CID 134536389) has the molecular formula C21H28ClF2N5S and a molecular weight of 456.01 g/mol. Its IUPAC name is N'-[2-chloro-5-fluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N-(pyrrolidin-2-ylmethyl)pentane-1,5-diamine.
| Compound Name | N'-[2-chloro-5-fluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N-(pyrrolidin-2-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 134536389 |
| Molecular Formula | C21H28ClF2N5S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N'-[2-chloro-5-fluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N-(pyrrolidin-2-ylmethyl)pentane-1,5-diamine |
| SMILES | Fc1cccc(NSc2cc(Cl)c(NCCCCCNCC3CCCN3)cc2F)n1 |
| InChI | InChI=1S/C21H28ClF2N5S/c22-16-12-19(30-29-21-8-4-7-20(24)28-21)17(23)13-18(16)27-10-3-1-2-9-25-14-15-6-5-11-26-15/h4,7-8,12-13,15,25-27H,1-3,5-6,9-11,14H2,(H,28,29) |
| InChIKey | ADBYOGFNWTVQKT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|