C19H23N5O3 — CID 134536396
3-[4-(3-cyclopentyl-1,2-oxazol-5-yl)butyl]-1-methylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 134536396) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[4-(3-cyclopentyl-1,2-oxazol-5-yl)butyl]-1-methylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 3-[4-(3-cyclopentyl-1,2-oxazol-5-yl)butyl]-1-methylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134536396 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[4-(3-cyclopentyl-1,2-oxazol-5-yl)butyl]-1-methylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(CCCCc2cc(C3CCCC3)no2)c(=O)c2cncnc21 |
| InChI | InChI=1S/C19H23N5O3/c1-23-17-15(11-20-12-21-17)18(25)24(19(23)26)9-5-4-8-14-10-16(22-27-14)13-6-2-3-7-13/h10-13H,2-9H2,1H3 |
| InChIKey | MELBWPLFMJMJQL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|