C17H14N4O4 — CID 134538180
4-[3-[(2-methyloxirane-2-carbonyl)amino]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 134538180) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-[3-[(2-methyloxirane-2-carbonyl)amino]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[3-[(2-methyloxirane-2-carbonyl)amino]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 134538180 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[3-[(2-methyloxirane-2-carbonyl)amino]phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | CC1(C(=O)Nc2cccc(-c3ncnc4[nH]cc(C(=O)O)c34)c2)CO1 |
| InChI | InChI=1S/C17H14N4O4/c1-17(7-25-17)16(24)21-10-4-2-3-9(5-10)13-12-11(15(22)23)6-18-14(12)20-8-19-13/h2-6,8H,7H2,1H3,(H,21,24)(H,22,23)(H,18,19,20) |
| InChIKey | LFYFUZGUSARYJG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|