About 2H-furan-5,5-dicarbaldehyde
2H-furan-5,5-dicarbaldehyde (PubChem CID 134539122) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 2H-furan-5,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 2H-furan-5,5-dicarbaldehyde |
| PubChem CID | 134539122 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2H-furan-5,5-dicarbaldehyde |
| SMILES | O=CC1(C=O)C=CCO1 |
| InChI | InChI=1S/C6H6O3/c7-4-6(5-8)2-1-3-9-6/h1-2,4-5H,3H2 |
| InChIKey | AVWZBYIOQHRMNF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2H-furan-5,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-furan-5,5-dicarbaldehyde?
The IUPAC name of 2H-furan-5,5-dicarbaldehyde (CID 134539122) is 2H-furan-5,5-dicarbaldehyde.
What is the SMILES notation for 2H-furan-5,5-dicarbaldehyde?
The canonical SMILES for 2H-furan-5,5-dicarbaldehyde is O=CC1(C=O)C=CCO1.
What is the InChIKey of 2H-furan-5,5-dicarbaldehyde?
The InChIKey is AVWZBYIOQHRMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-4-6(5-8)2-1-3-9-6/h1-2,4-5H,3H2.
What are the key properties of 2H-furan-5,5-dicarbaldehyde?
2H-furan-5,5-dicarbaldehyde has a molecular weight of 126.11 g/mol, XLogP of -0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-furan-5,5-dicarbaldehyde is sourced from PubChem (CID 134539122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).