C19H15N7O — CID 134539194
3-[2-[[1-(5-aminopyrazin-2-yl)cyclopropyl]amino]pyrimidine-5-carbonyl]benzonitrile (PubChem CID 134539194) has the molecular formula C19H15N7O and a molecular weight of 357.38 g/mol. Its IUPAC name is 3-[2-[[1-(5-aminopyrazin-2-yl)cyclopropyl]amino]pyrimidine-5-carbonyl]benzonitrile.
| Compound Name | 3-[2-[[1-(5-aminopyrazin-2-yl)cyclopropyl]amino]pyrimidine-5-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 134539194 |
| Molecular Formula | C19H15N7O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[2-[[1-(5-aminopyrazin-2-yl)cyclopropyl]amino]pyrimidine-5-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)c2cnc(NC3(c4cnc(N)cn4)CC3)nc2)c1 |
| InChI | InChI=1S/C19H15N7O/c20-7-12-2-1-3-13(6-12)17(27)14-8-24-18(25-9-14)26-19(4-5-19)15-10-23-16(21)11-22-15/h1-3,6,8-11H,4-5H2,(H2,21,23)(H,24,25,26) |
| InChIKey | MZYPHHZFXMWMOY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |