About 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene
1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene (PubChem CID 134539411) has the molecular formula C22H19NO2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene.
Molecular Properties
| Compound Name | 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene |
| PubChem CID | 134539411 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.CC(=O)c1cccc(C(C)=O)n1 |
| InChI | InChI=1S/C13H10.C9H9NO2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-6(11)8-4-3-5-9(10-8)7(2)12/h1-8H,9H2;3-5H,1-2H3 |
| InChIKey | ADDHCCMWFUQOHN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene?
The IUPAC name of 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene (CID 134539411) is 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene.
What is the SMILES notation for 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene?
The canonical SMILES for 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.CC(=O)c1cccc(C(C)=O)n1.
What is the InChIKey of 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene?
The InChIKey is ADDHCCMWFUQOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C9H9NO2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-6(11)8-4-3-5-9(10-8)7(2)12/h1-8H,9H2;3-5H,1-2H3.
What are the key properties of 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene?
1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene has a molecular weight of 329.40 g/mol, XLogP of 4.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-acetyl-2-pyridinyl)ethanone;1H-phenalene is sourced from PubChem (CID 134539411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).