About US10100058, Example 204
US10100058, Example 204 (PubChem CID 134539586) has the molecular formula C29H36N8O2S
and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-[(2S)-2-(diethylamino)propyl]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | US10100058, Example 204 |
| PubChem CID | 134539586 |
| Molecular Formula | C29H36N8O2S |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-[(2S)-2-(diethylamino)propyl]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide |
| SMILES | CCN(CC)[C@@H](C)CNC(=O)C1=CC(=NC(=C1)N2CCN(CC2)C(=O)C)C3=C4N=C(C=CN4N=C3)C5=CC=CS5 |
| InChI | InChI=1S/C29H36N8O2S/c1-5-34(6-2)20(3)18-30-29(39)22-16-25(32-27(17-22)36-13-11-35(12-14-36)21(4)38)23-19-31-37-10-9-24(33-28(23)37)26-8-7-15-40-26/h7-10,15-17,19-20H,5-6,11-14,18H2,1-4H3,(H,30,39)/t20-/m0/s1 |
| InChIKey | IIAWAQYTUODMAD-FQEVSTJZSA-N |
| XLogP | 2.50 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | 854 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze US10100058, Example 204 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10100058, Example 204?
The IUPAC name of US10100058, Example 204 (CID 134539586) is 2-(4-acetylpiperazin-1-yl)-N-[(2S)-2-(diethylamino)propyl]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide.
What is the SMILES notation for US10100058, Example 204?
The canonical SMILES for US10100058, Example 204 is CCN(CC)[C@@H](C)CNC(=O)C1=CC(=NC(=C1)N2CCN(CC2)C(=O)C)C3=C4N=C(C=CN4N=C3)C5=CC=CS5.
What is the InChIKey of US10100058, Example 204?
The InChIKey is IIAWAQYTUODMAD-FQEVSTJZSA-N. The full InChI is InChI=1S/C29H36N8O2S/c1-5-34(6-2)20(3)18-30-29(39)22-16-25(32-27(17-22)36-13-11-35(12-14-36)21(4)38)23-19-31-37-10-9-24(33-28(23)37)26-8-7-15-40-26/h7-10,15-17,19-20H,5-6,11-14,18H2,1-4H3,(H,30,39)/t20-/m0/s1.
What are the key properties of US10100058, Example 204?
US10100058, Example 204 has a molecular weight of 560.70 g/mol, XLogP of 2.50, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for US10100058, Example 204 is sourced from PubChem (CID 134539586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).