About US10100058, Example 148
US10100058, Example 148 (PubChem CID 134539611) has the molecular formula C26H29F2N7OS
and a molecular weight of 525.60 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)propyl]-2-(3,3-difluoroazetidin-1-yl)-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | US10100058, Example 148 |
| PubChem CID | 134539611 |
| Molecular Formula | C26H29F2N7OS |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-[(2S)-2-(diethylamino)propyl]-2-(3,3-difluoroazetidin-1-yl)-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide |
| SMILES | CCN(CC)[C@@H](C)CNC(=O)C1=CC(=NC(=C1)N2CC(C2)(F)F)C3=C4N=C(C=CN4N=C3)C5=CC=CS5 |
| InChI | InChI=1S/C26H29F2N7OS/c1-4-33(5-2)17(3)13-29-25(36)18-11-21(31-23(12-18)34-15-26(27,28)16-34)19-14-30-35-9-8-20(32-24(19)35)22-7-6-10-37-22/h6-12,14,17H,4-5,13,15-16H2,1-3H3,(H,29,36)/t17-/m0/s1 |
| InChIKey | HYIQISCFYZIORO-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | 782 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10100058, Example 148 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10100058, Example 148?
The IUPAC name of US10100058, Example 148 (CID 134539611) is N-[(2S)-2-(diethylamino)propyl]-2-(3,3-difluoroazetidin-1-yl)-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide.
What is the SMILES notation for US10100058, Example 148?
The canonical SMILES for US10100058, Example 148 is CCN(CC)[C@@H](C)CNC(=O)C1=CC(=NC(=C1)N2CC(C2)(F)F)C3=C4N=C(C=CN4N=C3)C5=CC=CS5.
What is the InChIKey of US10100058, Example 148?
The InChIKey is HYIQISCFYZIORO-KRWDZBQOSA-N. The full InChI is InChI=1S/C26H29F2N7OS/c1-4-33(5-2)17(3)13-29-25(36)18-11-21(31-23(12-18)34-15-26(27,28)16-34)19-14-30-35-9-8-20(32-24(19)35)22-7-6-10-37-22/h6-12,14,17H,4-5,13,15-16H2,1-3H3,(H,29,36)/t17-/m0/s1.
What are the key properties of US10100058, Example 148?
US10100058, Example 148 has a molecular weight of 525.60 g/mol, XLogP of 3.70, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10100058, Example 148 is sourced from PubChem (CID 134539611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).