C27H33N7O2S — CID 134539877
US10100058, Example 211 (PubChem CID 134539877) has the molecular formula C27H33N7O2S and a molecular weight of 519.70 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)propyl]-2-morpholin-4-yl-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide.
| Compound Name | US10100058, Example 211 |
|---|---|
| PubChem CID | 134539877 |
| Molecular Formula | C27H33N7O2S |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-[(2S)-2-(diethylamino)propyl]-2-morpholin-4-yl-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carboxamide |
| SMILES | CCN(CC)[C@@H](C)CNC(=O)C1=CC(=NC(=C1)N2CCOCC2)C3=C4N=C(C=CN4N=C3)C5=CC=CS5 |
| InChI | InChI=1S/C27H33N7O2S/c1-4-32(5-2)19(3)17-28-27(35)20-15-23(30-25(16-20)33-10-12-36-13-11-33)21-18-29-34-9-8-22(31-26(21)34)24-7-6-14-37-24/h6-9,14-16,18-19H,4-5,10-13,17H2,1-3H3,(H,28,35)/t19-/m0/s1 |
| InChIKey | FYHZELWOVJKBPP-IBGZPJMESA-N |
| XLogP | 2.90 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | 738 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |