About (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine
(2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine (PubChem CID 134540153) has the molecular formula C13H24F2N2
and a molecular weight of 246.34 g/mol. Its IUPAC name is (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine |
| PubChem CID | 134540153 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine |
| SMILES | CCN(CC)[C@@H](C)CN1CC2(CCC2(F)F)C1 |
| InChI | InChI=1S/C13H24F2N2/c1-4-17(5-2)11(3)8-16-9-12(10-16)6-7-13(12,14)15/h11H,4-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | HPQNIIBHFZXMMA-NSHDSACASA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine?
The IUPAC name of (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine (CID 134540153) is (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine.
What is the SMILES notation for (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine?
The canonical SMILES for (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine is CCN(CC)[C@@H](C)CN1CC2(CCC2(F)F)C1.
What is the InChIKey of (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine?
The InChIKey is HPQNIIBHFZXMMA-NSHDSACASA-N. The full InChI is InChI=1S/C13H24F2N2/c1-4-17(5-2)11(3)8-16-9-12(10-16)6-7-13(12,14)15/h11H,4-10H2,1-3H3/t11-/m0/s1.
What are the key properties of (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine?
(2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine has a molecular weight of 246.34 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(7,7-difluoro-2-azaspiro[3.3]heptan-2-yl)-N,N-diethylpropan-2-amine is sourced from PubChem (CID 134540153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).