C40H48N8O8 — CID 134541246
ethyl 5-[4,7,10-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,7,10-tetrazacyclododec-1-yl]pyridine-3-carboxylate (PubChem CID 134541246) has the molecular formula C40H48N8O8 and a molecular weight of 768.87 g/mol. Its IUPAC name is ethyl 5-[4,7,10-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,7,10-tetrazacyclododec-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[4,7,10-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,7,10-tetrazacyclododec-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134541246 |
| Molecular Formula | C40H48N8O8 |
| Molecular Weight | 768.87 g/mol |
| Exact Mass | 768.36 |
| IUPAC Name | ethyl 5-[4,7,10-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,7,10-tetrazacyclododec-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(N2CCN(c3cncc(C(=O)OCC)c3)CCN(c3cncc(C(=O)OCC)c3)CCN(c3cncc(C(=O)OCC)c3)CC2)c1 |
| InChI | InChI=1S/C40H48N8O8/c1-5-53-37(49)29-17-33(25-41-21-29)45-9-11-46(34-18-30(22-42-26-34)38(50)54-6-2)13-15-48(36-20-32(24-44-28-36)40(52)56-8-4)16-14-47(12-10-45)35-19-31(23-43-27-35)39(51)55-7-3/h17-28H,5-16H2,1-4H3 |
| InChIKey | IKKGSBXDTUSBCN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 169.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|